| Melting point |
207°C |
| Boiling point |
430.2±40.0 °C(Predicted) |
| Density |
1.171±0.06 g/cm3(Predicted) |
| refractive index |
8 ° (C=5, H2O) |
| storage temp. |
2-8°C |
| solubility |
Soluble in Water (up to 20 mg/ml). |
| pka |
2.24±0.10(Predicted) |
| form |
powder |
| color |
White |
| Odor |
Odorless |
| Water Solubility |
almost transparency |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in distilled water may be stored at -20° for up to 2 months. |
| InChI |
InChI=1S/C7H14N2O3/c1-2-9-5(7(11)12)3-4-6(8)10/h5,9H,2-4H2,1H3,(H2,8,10)(H,11,12)/t5-/m0/s1 |
| InChIKey |
DATAGRPVKZEWHA-YFKPBYRVSA-N |
| SMILES |
C(O)(=O)[C@H](CCC(N)=O)NCC |
| LogP |
-0.661 (est) |
| CAS DataBase Reference |
3081-61-6(CAS DataBase Reference) |
