| Melting point |
142~144℃ |
| Density |
0.98 |
| bulk density |
470kg/m3 |
| vapor pressure |
0Pa at 25℃ |
| Flash point |
285℃ |
| storage temp. |
room temp |
| solubility |
100g/l |
| form |
Fine Powder |
| Colour Index |
45430 |
| pka |
4.1(at 25℃) |
| color |
Deep red to brown |
| PH Range |
0(yellow)-3.6(red) |
| PH |
6-7 (10g/l, H2O, 20℃) |
| Water Solubility |
Soluble in water |
| ε(extinction coefficient) |
≥13000 at 308-312nm ≥32000 at 259-263nm |
| λmax |
525nm |
| Merck |
14,3693 |
| BRN |
1443945 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Detecting gene expression,phosphoproteins,protease,stress biomarkers; treating age-related macular degeneration,arteriosclerosis,bone metabolic diseases,burns,cancer,diabetes,human immunodeficiency virus infection,obesity |
| Major Application |
color filter, light emitting diodes, nanosensors, imaging materials, inks, paints, colored bubbles, detergents, cleaners, cosmetics, oral care agent, hair dyes, antiseptic, treatment of burns, diabetes, obesity, cancer, viral diseases, radio chemotheray, photodynamic therapy |
| Cosmetics Ingredients Functions |
HAIR DYEING COLORANT |
| InChI |
1S/C20H8I4O5.2Na/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20;;/h1-6,25-26H;;/q;2*+1/p-2 |
| InChIKey |
RAGZEDHHTPQLAI-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].[O-]c1c(I)cc2c(Oc3c(I)c([O-])c(I)cc3C24OC(=O)c5ccccc45)c1I |
| LogP |
-1.163 at 25℃ |
| CAS DataBase Reference |
16423-68-0 |
| EPA Substance Registry System |
Erythrosine B (16423-68-0) |