| Melting point |
320 °C(lit.) |
| Boiling point |
429.44°C (rough estimate) |
| Density |
1.2739 (rough estimate) |
| refractive index |
1.5000 (estimate) |
| storage temp. |
room temp |
| solubility |
Solubility Insoluble in water, ether, benzene, chloroform; soluble in ethanol, methanol, acetone, Iethyl acetate, N,N-dimethylformamide |
| Colour Index |
45350 |
| form |
Powder |
| pka |
2.2, 4.4, 6.7(at 25℃) |
| color |
Red to orange |
| PH Range |
Pink uorescence (4.0) to green uorescence (6.0) |
| Water Solubility |
insoluble |
| λmax |
493.5nm, 496nm, 460nm, 515nm |
| ε(extinction coefficient) |
≥12000 at 282-286nm ≥39000 at 236-240nm ≥70000 at 488-492nm |
| Merck |
14,4159 |
| BRN |
94324 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application |
Organic light-emitting diode, nanoparticles, liquid crystal display, oil products, lip make-up, nucleic acid synthesis, amplification, sequencing and cloning, diagnosis of diabetic retinopathy, detecting yeast, multidrug resistance, proteins, antiHCV antibodies, target genes, enzymatic activity, nerve agent, nucleic acid sequences, imaging lung cancer, prostate cancer |
| Biological Applications |
Detecting
chromosomal aberration; diagnosing corneal
diseases; marking/detecting insects; as antitumor
agent; as antihistaminic agent; use in agriculture
and plant cultivation; use in cosmetics; use in
ophthalmology; as a substrate for measuring
α-amylases activity, elastases activity, esterases
activity, β-glucuronidases activity, horseradish
peroxidases activity, kinases activity, monoamine
oxidases (MAOs) activity, phosphatases activity,
phospholipases activity, proteases/proteinases
activity, telomerases activity activity |
| Cosmetics Ingredients Functions |
HAIR DYEING COLORANT |
| InChI |
1S/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H |
| InChIKey |
GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| SMILES |
Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5ccccc45)c1 |
| LogP |
2.980 (est) |
| CAS DataBase Reference |
2321-07-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Fluorescein (2321-07-5) |