| Melting point |
101-102 °C(lit.) |
| Boiling point |
310-312 °C(lit.) |
| Density |
1.0368 (rough estimate) |
| refractive index |
1.5994 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| pka |
30 |
| color |
White to Light yellow to Dark green |
| Water Solubility |
soluble |
| BRN |
133939 |
| Stability |
Stable. Combustible. Incompatible with oxidizing agents. |
| InChI |
InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2 |
| InChIKey |
GJCOSYZMQJWQCA-UHFFFAOYSA-N |
| SMILES |
C1C2=C(C=CC=C2)OC2=C1C=CC=C2 |
| LogP |
4.230 |
| CAS DataBase Reference |
92-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Xanthene(92-83-1) |
| EPA Substance Registry System |
9H-Xanthene (92-83-1) |