| Melting point |
211-213 °C (dec.) (lit.) |
| Boiling point |
272.96°C (rough estimate) |
| Density |
1.2933 (rough estimate) |
| refractive index |
1.4500 (estimate) |
| storage temp. |
2-8°C |
| solubility |
ethanol: 50 mg/mL |
| form |
powder |
| pka |
4.58±0.10(Predicted) |
| color |
yellow to tan |
| Water Solubility |
soluble in hot water |
| Merck |
14,1635 |
| BRN |
2210883 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Cosmetics Ingredients Functions |
FRAGRANCE ANTIOXIDANT |
| InChI |
1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
| InChIKey |
QAIPRVGONGVQAS-DUXPYHPUSA-N |
| SMILES |
OC(=O)\C=C\c1ccc(O)c(O)c1 |
| LogP |
1.150 |
| CAS DataBase Reference |
331-39-5(CAS DataBase Reference) |
| IARC |
2B (Vol. 56) 1993 |
| NIST Chemistry Reference |
Cinnamic acid, 3,4-dihydroxy-(331-39-5) |
| EPA Substance Registry System |
2-Propenoic acid, 3-(3,4-dihydroxyphenyl)- (331-39-5) |