| Melting point |
450 °C |
| Density |
1.124 g/mL at 25 °C (lit.) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
water: soluble |
| form |
Crystalline Powder |
| color |
White to off-white |
| Water Solubility |
soluble |
| Sensitive |
Hygroscopic |
| Merck |
14,1070 |
| BRN |
3918459 |
| Stability |
Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C6H6O3S.Na.H/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);; |
| InChIKey |
MZSDGDXXBZSFTG-UHFFFAOYSA-M |
| SMILES |
S(C1C=CC=CC=1)(O)(=O)=O.[NaH] |
| CAS DataBase Reference |
515-42-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, sodium salt (515-42-4) |
