515-42-4
| Name | Benzenesulfonic acid sodium salt |
| CAS | 515-42-4 |
| EINECS(EC#) | 208-198-2 |
| Molecular Formula | C6H5NaO3S |
| MDL Number | MFCD00065179 |
| Molecular Weight | 180.16 |
| MOL File | 515-42-4.mol |
Chemical Properties
| Appearance | off-white crystalline powder |
| Melting point | 450 °C |
| density | 1.124 g/mL at 25 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble |
| form | Crystalline Powder |
| color | White to off-white |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 1070 |
| BRN | 3918459 |
| InChI | InChI=1S/C6H6O3S.Na.H/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);; |
| InChIKey | MZSDGDXXBZSFTG-UHFFFAOYSA-M |
| SMILES | S(C1C=CC=CC=1)(O)(=O)=O.[NaH] |
| CAS DataBase Reference | 515-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | 515-42-4(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DB7350000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 515-42-4(Hazardous Substances Data) |