| Melting point |
300 °C |
| Density |
0.987 g/mL at 25 °C |
| bulk density |
200-400kg/m3 |
| Flash point |
37 °C |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
5g/l |
| Colour Index |
13025 |
| form |
Powder/Solid |
| pka |
3.4(at 25℃) |
| color |
Yellow-Orange |
| Specific Gravity |
0.987 |
| Odor |
Odorless |
| PH |
6.5 (5g/l, H2O, 20℃) |
| PH Range |
3.1(Red)-4.4(Orange) |
| Water Solubility |
Soluble in ethanol. Partially soluble in hot water. Slightly soluble in cold water and pyrimidine. Insoluble in ether and alcohol. |
| λmax |
507nm, 522nm, 464nm |
| Merck |
14,6105 |
| BRN |
4732884 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Detecting microorganisms; treating dermatological diseases,vaginal affections; dental materials; wound dressing materials |
| Major Application |
Liquid crystals, thin films, sensors, sol-gel matrix, waveguides, host-guest chemistry, display device, corrosion inhibitor, glass coatings, paints, wound dressing materials, pharmaceuticals, dental materials, measuring nucleic acid |
| InChI |
1S/C14H15N3O3S.Na/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)21(18,19)20;/h3-10H,1-2H3,(H,18,19,20);/q;+1/p-1/b16-15+; |
| InChIKey |
STZCRXQWRGQSJD-GEEYTBSJSA-M |
| SMILES |
[Na+].CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)S([O-])(=O)=O |
| CAS DataBase Reference |
547-58-0 |
| EPA Substance Registry System |
Methyl orange (547-58-0) |
