| Melting point |
108-112 °C (lit.) |
| Boiling point |
318.03°C (rough estimate) |
| Density |
1,683 g/cm3 |
| vapor density |
6.35 (vs air) |
| vapor pressure |
39(x 10-5 mmHg) at 20 °C (Schwarzenbach et al., 1988) |
| refractive index |
1.4738 (estimate) |
| Flash point |
11 °C |
| storage temp. |
2-8°C |
| solubility |
Solubility Sparingly soluble in water; soluble in ethanol, benzene |
| pka |
3.96(at 15℃) |
| form |
crystals |
| color |
Light yellow |
| PH Range |
2.8(colourless)-4.7(yellow) |
| Odor |
Sweet, musty |
| Water Solubility |
0.6 g/100 mL (18 ºC) |
| Sensitive |
Light Sensitive |
| Merck |
14,3280 |
| BRN |
1246142 |
| Henry's Law Constant |
5.70 x 10-8(atmm3/mol) at 5 °C (average derived from six field experiments, Lüttke and Levsen, 1997) |
| Stability |
Stable. Combustible. |
| Major Application |
Display device, recording materials, inks, paints, method for preserving food, method for gene expression profiling, treatment of parasitic diseases, neurological diseases, epilepsy, cancer, keratin materials, neoplasms, infectious diseases, neutropenia, detecting chromosome aberrations, bacteria in gastrointestinal track |
| InChI |
1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H |
| InChIKey |
UFBJCMHMOXMLKC-UHFFFAOYSA-N |
| SMILES |
Oc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference |
51-28-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phenol, 2,4-dinitro-(51-28-5) |
| EPA Substance Registry System |
2,4-Dinitrophenol (51-28-5) |