| Melting point |
67-70 °C(lit.) |
| Boiling point |
300 °C |
| Density |
1,521 g/cm3 |
| vapor pressure |
1 mm Hg ( 102.7 °C) |
| refractive index |
1.4420 |
| Flash point |
155 °C |
| storage temp. |
2-8°C |
| solubility |
Soluble in acetone, ethanol, benzene, ether, and pyrimidine (Weast, 1986) |
| form |
solid |
| pka |
13.53 (Perrin, 1972) |
| Water Solubility |
0.3 g/L (20 ºC) |
| BRN |
1912834 |
| Henry's Law Constant |
5.39(x 10-8 atmm3/mol) at 25 °C (thermodynamic method-GC/UV spectrophotometry, Altschuh et al., 1999) |
| Stability |
Stable. Incompatible with oxidizing agents, reducing agents, strong bases. |
| Major Application |
cleaning products cosmetics environmental food and beverages personal care |
| InChI |
1S/C7H6N2O4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3 |
| InChIKey |
RMBFBMJGBANMMK-UHFFFAOYSA-N |
| SMILES |
CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference |
121-14-2(CAS DataBase Reference) |
| IARC |
2B (Vol. 65) 1996 |
| NIST Chemistry Reference |
Benzene, 1-methyl-2,4-dinitro-(121-14-2) |
| EPA Substance Registry System |
2,4-Dinitrotoluene (121-14-2) |