| Melting point |
83-85 °C(lit.) |
| Boiling point |
196°C 1012mm |
| Density |
1.5928 (rough estimate) |
| vapor pressure |
5.2(x 10-5 mmHg) at 25 °C (Melnikov, 1971)5(x 10-5 mmHg) at 20 °C (ACGIH, 1986) |
| refractive index |
1.5460 (estimate) |
| Flash point |
11 °C |
| storage temp. |
0-6°C |
| solubility |
Solubility Sparingly soluble in water; readily soluble in ethanol, acetone, ether |
| pka |
4.42(at 25℃) |
| form |
buffered aqueous solution |
| color |
Yellow prisms |
| PH Range |
Colorless (2.4) to yellow (3.8) |
| biological source |
rabbit |
| Water Solubility |
slightly soluble |
| Merck |
3279 |
| BRN |
2054389 |
| Henry's Law Constant |
1.4(x 10-6 atmm3/mol) at 25 °C (gas stripping-UV spectrophotometry, Warner et al., 1987) |
| Exposure limits |
ACGIH:TLV-TWA 0.2 mg/m3,Inhalable fraction and vapor OSHA:PEL-TWA 0.2 mg/m3 NIOSH:REL-TWA 0.2 mg/m3 |
| Major Application |
Explosives, fungicides, herbicides, insecticides, pesticides, antitumor agent |
| InChI |
1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3 |
| InChIKey |
ZXVONLUNISGICL-UHFFFAOYSA-N |
| SMILES |
Cc1cc(cc(c1O)[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference |
534-52-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phenol, 2-methyl-4,6-dinitro-(534-52-1) |
| EPA Substance Registry System |
4,6-Dinitro-o-cresol (534-52-1) |