| Melting point |
197-200 °C (lit.) |
| Boiling point |
335.43°C (rough estimate) |
| Density |
0.843 g/mL at 20 °C |
| refractive index |
n20/D 1.374 |
| Flash point |
14 °C |
| storage temp. |
2-8°C |
| solubility |
50% sulfuric acid: 10 mg/mL, clear, colorless |
| pka |
12.1(at 25℃) |
| form |
crystals |
| color |
Red |
| PH Range |
Yellow (11.0) to brown (12.5) |
| Water Solubility |
slightly soluble |
| Merck |
14,3283 |
| BRN |
615586 |
| Stability |
Stable when wet, but explosive when dry. May be shock sensitive when dry. Highly flammable. Incompatible with strong oxidizing agents. |
| Major Application |
Fuel cells, detecting microorganisms, antibacterial agent, treatment of acuteand chronic hepatitis, gynecopathy, cardiovascular diseases, cerebrovascular diseases |
| InChI |
1S/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2 |
| InChIKey |
HORQAOAYAYGIBM-UHFFFAOYSA-N |
| SMILES |
NNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference |
119-26-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
Hydrazine, (2,4-dinitrophenyl)-(119-26-6) |
| EPA Substance Registry System |
2,4-Dinitrophenylhydrazine (119-26-6) |