| Melting point |
86 °C |
| Boiling point |
297 °C(lit.) |
| Density |
1.575 |
| vapor pressure |
8.15 x 10-4 mmHg at 35 °C (Hine et al., 1963) |
| refractive index |
1.4660 (estimate) |
| Flash point |
150 °C |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Sparingly), DMSO (Slightly), Methanol (Very Slightly) |
| form |
solid |
| Specific Gravity |
1.368 |
| color |
White to yellowish crystals |
| Water Solubility |
500 mg/L (20 ºC) |
| Specific Heat Capacity |
Cp(crystal): 1.17 J/(g·K), at 25℃ |
| Merck |
14,3273 |
| BRN |
1105654 |
| Henry's Law Constant |
1.8×102 mol/(m3Pa) at 25℃, Chao et al. (2017) |
| Exposure limits |
ACGIH:TLV-TWA 0.15 ppm (1 mg/m3),Inhalable fraction,and vapor OSHA:PEL-TWA 1 mg/m3 NIOSH:REL-TWA 1 mg/m3 |
| Dielectric constant |
2.8(20.0℃) |
| Stability |
Stable. Incompatible with reducing agents, oxidizing agents, strong bases. May explode if heated. |
| Major Application |
environmental |
| InChI |
1S/C6H4N2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H |
| InChIKey |
WDCYWAQPCXBPJA-UHFFFAOYSA-N |
| SMILES |
[O-][N+](=O)c1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference |
99-65-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzene, 1,3-dinitro-(99-65-0) |
| EPA Substance Registry System |
m-Dinitrobenzene (99-65-0) |