| Melting point |
3-4 °C (lit.) |
| Boiling point |
228-229 °C/720 mmHg (lit.) |
| Density |
0.945 g/mL at 25 °C (lit.) |
| vapor pressure |
23.3hPa at 20℃ |
| refractive index |
n20/D 1.409(lit.) |
| Flash point |
76 °F |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| pka |
23-25(at 25℃) |
| form |
liquid |
| Specific Gravity |
0.959 |
| color |
Colorless to Light yellow to Light orange |
| Water Solubility |
935.5μg/L at 20℃ |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
1794624 |
| InChI |
1S/C9H27O4PSi3/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9/h1-9H3 |
| InChIKey |
QJMMCGKXBZVAEI-UHFFFAOYSA-N |
| SMILES |
C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP |
4.72 at 20℃ |
| CAS DataBase Reference |
10497-05-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Silanol, trimethyl-, phosphate (3:1) (10497-05-9) |
