7-MAC
- Product Name7-MAC
- CAS56610-72-1
- CBNumberCB7825370
- MFC24H24N6O4S2
- MW524.62
- EINECS611-404-7
- MDL NumberMFCD08704705
- MOL File56610-72-1.mol
Chemical Properties
| Melting point: | 120°C(lit.) |
| Boiling point: | 743.2±70.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 3.39±0.60(Predicted) |
| color | Pale Yellow to Yellow |
| InChIKey | QGXKMJVEULWQSB-VWNXMTODSA-N |
| SMILES | N12[C@@]([H])([C@@](N)(OC)C1=O)SCC(CSC1N(C)N=NN=1)=C2C(OC(C1=CC=CC=C1)C1=CC=CC=C1)=O |
Safety
| Symbol(GHS) |
 GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P285-P304+P341-P342+P311-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| RIDADR | UN1325 |
| HazardClass | 4.1 |
| REACH Registrations | Active |
| Limited Quantities | 5.0 Kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |