7-Amino-3-methyl-3-cephem-4-carboxylic acid
- Product Name7-Amino-3-methyl-3-cephem-4-carboxylic acid
- CAS22252-43-3
- CBNumberCB7497894
- MFC8H10N2O3S
- MW214.24
- EINECS244-870-1
- MDL NumberMFCD00151456
- MOL File22252-43-3.mol
Chemical Properties
| Melting point: | 234°C (dec.) |
| Boiling point: | 517.6±50.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 104 ° (C=1, 1mol/L HCl) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder |
| pka | 3.04±0.50(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Soluble in water (partly), 1M ammonium hydroxide (50 mg/ml), and DMSO (Sparingly). |
| BRN | 5273616 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H10N2O3S/c1-3-2-14-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13)/t4-,7-/m1/s1 |
| InChIKey | NVIAYEIXYQCDAN-CLZZGJSISA-N |
| SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(C)=C2C(O)=O |
| LogP | -3.8--2.8 at 20℃ and pH3.6-7 |
| CAS DataBase Reference | 22252-43-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H412 | |||||||||
| Precautionary statements | P273-P501 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 42/43-36/37/38-20/21/22 | |||||||||
| Safety Statements | 36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2941901010 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Chronic 3 | |||||||||
| NFPA 704: |
|