1-Bromo-2-ethylbutane
- Product Name1-Bromo-2-ethylbutane
- CAS3814-34-4
- CBNumberCB6233176
- MFC6H13Br
- MW165.07
- EINECS223-302-6
- MDL NumberMFCD00000219
- MOL File3814-34-4.mol
Chemical Properties
| Melting point: | -44.22°C (estimate) |
| Boiling point: | 145 °C |
| Density | 1.19 |
| refractive index | 1.45 |
| Flash point: | 36 °C |
| storage temp. | Refrigerator (+4°C) + Flammables area |
| form | clear liquid |
| Specific Gravity | 1.179 |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H13Br/c1-3-6(4-2)5-7/h6H,3-5H2,1-2H3 |
| InChIKey | KKGUMGWNFARLSL-UHFFFAOYSA-N |
| SMILES | CCC(CBr)CC |
| CAS DataBase Reference | 3814-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentane, 3-(bromomethyl)-(3814-34-4) |
| EPA Substance Registry System | Pentane, 3-(bromomethyl)- (3814-34-4) |
Safety
| Symbol(GHS) |
 GHS02 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501-P241-P280a-P501a | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 36/37/38-10 | |||||||||
| Safety Statements | 37/39-26-16-33-29 | |||||||||
| RIDADR | UN 1993 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903399090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|