GOSSYPIN
- Product NameGOSSYPIN
- CAS652-78-8
- CBNumberCB2385161
- MFC21H20O13
- MW480.38
- MDL NumberMFCD00017429
- MOL File652-78-8.mol
Chemical Properties
| Melting point: | 229-230°C |
| Boiling point: | 886.0±65.0 °C(Predicted) |
| Density | 1.883±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | DMSO: soluble15mg/mL, clear |
| form | powder |
| pka | 5.70±0.40(Predicted) |
| color | light yellow to dark green-yellow |
| Major Application | food and beverages |
| InChIKey | SJRXVLUZMMDCNG-KKPQBLLMSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2c(O)cc(O)c3C(=O)C(O)=C(Oc23)c4ccc(O)c(O)c4)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.320 (est) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-62-37/38-36-22 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| RTECS | DJ3009900 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |