652-78-8
| Name | GOSSYPIN |
| CAS | 652-78-8 |
| Molecular Formula | C21H20O13 |
| MDL Number | MFCD00017429 |
| Molecular Weight | 480.38 |
| MOL File | 652-78-8.mol |
Chemical Properties
| Melting point | 229-230°C |
| Boiling point | 886.0±65.0 °C(Predicted) |
| density | 1.883±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | DMSO: soluble15mg/mL, clear |
| form | powder |
| pka | 5.70±0.40(Predicted) |
| color | light yellow to dark green-yellow |
| Major Application | food and beverages |
| InChIKey | SJRXVLUZMMDCNG-KKPQBLLMSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2c(O)cc(O)c3C(=O)C(O)=C(Oc23)c4ccc(O)c(O)c4)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.320 (est) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DJ3009900 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |