2-Methyl-3-nitrobenzyl chloride
- Product Name2-Methyl-3-nitrobenzyl chloride
- CAS60468-54-4
- CBNumberCB0212186
- MFC8H8ClNO2
- MW185.61
- EINECS262-249-3
- MDL NumberMFCD00007165
- MOL File60468-54-4.mol
Chemical Properties
| Melting point: | 43-46 °C (lit.) |
| Boiling point: | 299.7±25.0 °C(Predicted) |
| Density | 1.2797 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C8H8ClNO2/c1-6-7(5-9)3-2-4-8(6)10(11)12/h2-4H,5H2,1H3 |
| InChIKey | XZNDXQGZPOZITR-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 60468-54-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338-P310 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 26-27-28-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29049095 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|||||||||
| NFPA 704: |
|