1,2-Dichloro-4-(chloromethyl)benzene
- Product Name1,2-Dichloro-4-(chloromethyl)benzene
- CAS102-47-6
- CBNumberCB7425213
- MFC7H5Cl3
- MW195.47
- EINECS203-033-0
- MDL NumberMFCD00000906
- MOL File102-47-6.mol
Chemical Properties
| Melting point: | -3 °C |
| Boiling point: | 241 °C |
| Density | 1.42 |
| refractive index | 1.58 |
| Flash point: | 155 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform, Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.409 |
| BRN | 386644 |
| InChI | InChI=1S/C7H5Cl3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| InChIKey | YZIFVWOCPGPNHB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(CCl)C=C1Cl |
| CAS DataBase Reference | 102-47-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-dichloro-4-(chloromethyl)-(102-47-6) |
| EPA Substance Registry System | Benzene, 1,2-dichloro-4-(chloromethyl)- (102-47-6) |
Safety
| Symbol(GHS) |
  GHS05,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H411-H290 | |||||||||
| Precautionary statements | P501-P273-P234-P264-P280-P390-P391-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 19 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903999090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|