4-Nitrobenzyl chloroformate
- Product Name4-Nitrobenzyl chloroformate
- CAS4457-32-3
- CBNumberCB7438752
- MFC8H6ClNO4
- MW215.59
- EINECS224-708-6
- MDL NumberMFCD00007375
- MOL File4457-32-3.mol
Chemical Properties
| Melting point: | 32-34 °C(lit.) |
| Boiling point: | 230°C 10mm |
| Density | 1.4928 (rough estimate) |
| refractive index | 1.552-1.556 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 912446 |
| Stability: | Stable, but moisture-sensitive. May develop pressure in storage. Incompatible with moisture, strong bases, alcohols, amines, acids. |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6ClNO4/c9-8(11)14-5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChIKey | MHSGOABISYIYKP-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(COC(Cl)=O)cc1 |
| CAS DataBase Reference | 4457-32-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonochloridic acid, (4-nitrophenyl)methyl ester(4457-32-3) |
| EPA Substance Registry System | Carbonochloridic acid, (4-nitrophenyl)methyl ester (4457-32-3) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,T | |||||||||
| Risk Statements | 34-37-23/24/25-36/37 | |||||||||
| Safety Statements | 26-36/37/39-45-38-28A-27 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-4.9 | |||||||||
| Hazard Note | Corrosive/Toxic/Moisture Sensitive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|