4457-32-3
| Name | 4-Nitrobenzyl chloroformate |
| CAS | 4457-32-3 |
| EINECS(EC#) | 224-708-6 |
| Molecular Formula | C8H6ClNO4 |
| MDL Number | MFCD00007375 |
| Molecular Weight | 215.59 |
| MOL File | 4457-32-3.mol |
Chemical Properties
| Appearance | off-white to pale yellow powder |
| Melting point | 32-34 °C(lit.) |
| Boiling point | 230°C 10mm |
| density | 1.4928 (rough estimate) |
| refractive index | 1.552-1.556 |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| Stability: | Stable, but moisture-sensitive. May develop pressure in storage. Incompatible with moisture, strong bases, alcohols, amines, acids. |
| Sensitive | Moisture Sensitive |
| BRN | 912446 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6ClNO4/c9-8(11)14-5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChIKey | MHSGOABISYIYKP-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(COC(Cl)=O)cc1 |
| CAS DataBase Reference | 4457-32-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonochloridic acid, (4-nitrophenyl)methyl ester(4457-32-3) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-4.9 |
| Hazard Note | Corrosive/Toxic/Moisture Sensitive |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |