Trifluoromethanesulfonimide
- Product NameTrifluoromethanesulfonimide
- CAS82113-65-3
- CBNumberCB9355545
- MFC2HF6NO4S2
- MW281.15
- EINECS435-300-4
- MDL NumberMFCD00214154
- MOL File82113-65-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 52-56 °C |
| Boiling point | 90-91 °C(lit.) |
| Density | 1.36 |
| storage temp. | 2-8°C |
| solubility | 800g/l Risk of violent reaction. |
| form | Crystals |
| pka | -10.42±0.40(Predicted) |
| color | Colorless to brownish |
| PH | 0.8 (100g/l, H2O, 20℃)Risk of violent reaction. |
| BRN | 4754101 |
| Stability | Stable. Incompatible with strong oxidizing agents. Reacts violently with water. |
| InChI | 1S/C2HF6NO4S2/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9H |
| InChIKey | ZXMGHDIOOHOAAE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| LogP | -0.771 at 25.5℃ and pH6.7 |
| CAS DataBase Reference | 82113-65-3(CAS DataBase Reference) |
| FDA UNII | C7R849VM9L |
| EPA Substance Registry System | Methanesulfonamide, 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]- (82113-65-3) |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H318-H412 | |||||||||
| Precautionary statements | P273-P280-P301+P310+P330-P305+P351+P338+P310 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-40-14-67-37 | |||||||||
| Safety Statements | 26-36/37/39-45-8 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10-21 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 29350090 | |||||||||
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 | |||||||||
| NFPA 704: |
|

