1-Butyl-3-methylimidazolium bis(trifluor
- Product Name1-Butyl-3-methylimidazolium bis(trifluor
- CAS174899-83-3
- CBNumberCB7497748
- MFC8H15N2.C2F6NO4S2
- MW419.366
- EINECS205-516-1
- MDL NumberMFCD05664714
- MOL File174899-83-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -2 °C |
| Density | 1.44 |
| refractive index | 1.43 |
| Flash point | Not applicable |
| storage temp. | Store below +30°C. |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| PH | 7 (H2O, 20℃)Aqueous solution |
| Viscosity | 48.8 cP |
| InChI | InChI=1S/C8H15N2.C2F6NO4S2/c1-3-4-5-10-7-6-9(2)8-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | INDFXCHYORWHLQ-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(C)C=CN(CCCC)C=1 |
| Comptox DTXSID | DTXSID0049234 |
| ECW | 4,62 V |
| UNSPSC Code | 12352200 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
   
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311-H314-H373-H411 | |||||||||
| Precautionary statements | P260-P280-P301+P330+P331+P310-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 36/37/38-51/53-48/22-34-24/25 | |||||||||
| Safety Statements | 26-36-61-45-36/37/39 | |||||||||
| RIDADR | UN 2922 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8, 6.1 | |||||||||
| HS Code | 29350090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B STOT RE 2 Oral | |||||||||
| NFPA 704: |
|
