Zinc trifluoromethanesulfonate
- Product NameZinc trifluoromethanesulfonate
- CAS54010-75-2
- CBNumberCB8137568
- MFC2F6O6S2Zn
- MW363.53
- EINECS258-922-6
- MDL NumberMFCD00013229
- MOL File54010-75-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | ≥300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White to light-gray |
| Water Solubility | Soluble in water and acetonitrile. Slightly soluble in methanol. Insoluble in dichloromethane. |
| Sensitive | Hygroscopic |
| BRN | 4028195 |
| Stability | hygroscopic |
| InChI | InChI=1S/2CHF3O3S.Zn/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChIKey | CITILBVTAYEWKR-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Zn+2] |
| CAS DataBase Reference | 54010-75-2(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, zinc salt (54010-75-2) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P501a-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10 | |||||||||
| Hazard Note | Irritant/Hygroscopic | |||||||||
| TSCA | Yes | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049090 | |||||||||
| NFPA 704: |
|
