2,2′-Azobis(2-methylpropionamidine) dihydrochloride
- Product Name2,2′-Azobis(2-methylpropionamidine) dihydrochloride
- CAS2997-92-4
- CBNumberCB6138677
- MFC8H20Cl2N6
- MW271.19
- EINECS221-070-0
- MDL NumberMFCD00142725
- MOL File2997-92-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 175-177 °C(lit.) |
| Density | 0.42 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 0-6°C |
| solubility | acetone, dioxane, methanol, ethanol, DMSO and water: soluble |
| form | granular |
| color | White to off-white |
| Water Solubility | 176.2g/L at 20℃ |
| Stability | Unstable. Sensitive to heat and light. Incompatible with strong oxidizing agents, strong acids. |
| InChI | InChI=1S/C8H18N6.2ClH/c1-7(2,5(9)10)13-14-8(3,4)6(11)12;;/h1-4H3,(H3,9,10)(H3,11,12);2*1H/b14-13+;; |
| InChIKey | LXEKPEMOWBOYRF-QDBORUFSSA-N |
| SMILES | C(C)(C)(/N=N/C(C)(C)C(=N)N)C(=N)N.Cl.Cl |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 2997-92-4(CAS DataBase Reference) |
| FDA UNII | 7381JDR72F |
| EPA Substance Registry System | Propanimidamide, 2,2'-azobis[2-methyl-, dihydrochloride (2997-92-4) |
| UNSPSC Code | 12162002 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H251-H302-H317-H319-H410 | |||||||||
| Precautionary statements | P235-P273-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-43-5 | |||||||||
| Safety Statements | 24-37 | |||||||||
| RIDADR | UN 3226 4.1 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | UE4575500 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29270000 | |||||||||
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Self-heat. 1 Skin Sens. 1 | |||||||||
| Toxicity | LD50 oral in rat: 410mg/kg | |||||||||
| NFPA 704: |
|
