2997-92-4
| Name | 2,2'-Azobis(2-methylpropionamidine) dihydrochloride |
| CAS | 2997-92-4 |
| EINECS(EC#) | 221-070-0 |
| Molecular Formula | C8H20Cl2N6 |
| MDL Number | MFCD00142725 |
| Molecular Weight | 271.19 |
| MOL File | 2997-92-4.mol |
Chemical Properties
| Appearance | light yellow crystalline powder |
| Melting point | 175-177 °C(lit.) |
| density | 0.42 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 0-6°C |
| solubility | acetone, dioxane, methanol, ethanol, DMSO and water: soluble |
| form | granular |
| color | White to off-white |
| Stability: | Unstable. Sensitive to heat and light. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility | 176.2g/L at 20℃ |
| Detection Methods | NMR,HPLC |
| InChI | InChI=1S/C8H18N6.2ClH/c1-7(2,5(9)10)13-14-8(3,4)6(11)12;;/h1-4H3,(H3,9,10)(H3,11,12);2*1H/b14-13+;; |
| InChIKey | LXEKPEMOWBOYRF-QDBORUFSSA-N |
| SMILES | C(C)(C)(/N=N/C(C)(C)C(=N)N)C(=N)N.Cl.Cl |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 2997-92-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2997-92-4(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H251-H302-H317-H319-H410 |
| Precautionary statements | P235-P273-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3226 4.1 |
| WGK Germany | 1 |
| RTECS | UE4575500 |
| F | 10-21 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Self-heat. 1 Skin Sens. 1 |
| Toxicity |