Diethyl azodicarboxylate
- Product NameDiethyl azodicarboxylate
- CAS1972-28-7
- CBNumberCB6432076
- MFC6H10N2O4
- MW174.15
- EINECS217-821-7
- MDL NumberMFCD00009103
- MOL File1972-28-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 6°C |
| Boiling point | 106°C (13 mmHg) |
| Density | 1.106 |
| refractive index | n |
| Flash point | 85°C |
| storage temp. | 2-8°C |
| solubility | Miscible with dichloromethane, diethyl ether and toluene. |
| form | liquid |
| color | Clear, orange |
| Sensitive | Air Sensitive |
| BRN | 908662 |
| Stability | Stable, but may explode if heated under confinement. May be shock sensitive. Decomposes vigorously if heated above 100 C. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. Light sensitive. |
| InChI | InChI=1S/C6H10N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3 |
| InChIKey | FAMRKDQNMBBFBR-FPLPWBNLSA-N |
| SMILES | N(C(OCC)=O)=NC(OCC)=O |
| CAS DataBase Reference | 1972-28-7(CAS DataBase Reference) |
| FDA UNII | D31B4839S8 |
| NIST Chemistry Reference | Diethyl azo diformate(1972-28-7) |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H242-H304-H315-H319-H335-H336-H361d-H373-H412 | |||||||||
| Precautionary statements | P210-P301+P310-P331-P370+P378-P403+P233-P403+P235 | |||||||||
| Hazard Codes | F,Xn,Xi | |||||||||
| Risk Statements | 5-11-20-36/37/38-48/20-63-65-67-48/20/22-40-20/22-20/21/22-10 | |||||||||
| Safety Statements | 26-36/37-62-47-36-35 | |||||||||
| RIDADR | UN 3233 4.1 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9 | |||||||||
| Hazard Note | Toxic/Irritant/Flammable | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29270000 | |||||||||
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | |||||||||
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 3 Repr. 2 Self-react. C Skin Irrit. 2 STOT RE 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
