Perfluorodecanoic acid
- Product NamePerfluorodecanoic acid
- CAS335-76-2
- CBNumberCB5341889
- MFC10HF19O2
- MW514.08
- EINECS206-400-3
- MDL NumberMFCD00004175
- MOL File335-76-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 77-81 °C (lit.) |
| Boiling point | 218 °C/740 mmHg (lit.) |
| Density | 1.7490 (estimate) |
| vapor pressure | ~10 mm Hg ( 0 °C) |
| Flash point | 218°C |
| storage temp. | 2-8°C |
| solubility | methanol: soluble10%, clear to very slightly hazy, colorless to faintly yellow |
| pka | 0.52±0.10(Predicted) |
| form | A liquid |
| color | White to Almost white |
| BRN | 1810811 |
| Henry's Law Constant | 2.5×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) |
| Stability | Stable. Incompatible with strong bases, oxidizing agents, reducing agents. |
| InChI | 1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
| InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Substances of Very High Concern (SVHC) Candidate List | Nonadecafluorodecanoic acid (PFDA) and its sodium and ammonium salts (335-76-2) |
| REACH Annex XVII Substances List | Nonadecafluorodecanoic acid (335-76-2) |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H351-H360Df-H362 | |||||||||
| Precautionary statements | P202-P260-P263-P264-P270-P301+P310 | |||||||||
| Hazard Codes | T,C | |||||||||
| Risk Statements | 25-36/37/38 | |||||||||
| Safety Statements | 26-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | HD9900000 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Lact. Repr. 1B | |||||||||
| Toxicity | LD50 orl-rat: 57 mg/kg TXAPA9 85,169,86 | |||||||||
| NFPA 704: |
|

