1H,1H,9H-Hexadecafluoro-1-nonanol
- Product Name1H,1H,9H-Hexadecafluoro-1-nonanol
- CAS376-18-1
- CBNumberCB6446077
- MFC9H4F16O
- MW432.1
- EINECS206-806-0
- MDL NumberMFCD00039629
- MOL File376-18-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 53-59 °C(lit.) |
| Boiling point | 155-156 °C200 mm Hg(lit.) |
| Density | 1.6319 (estimate) |
| Flash point | 157-158°C/200mm |
| storage temp. | Store at room temperature |
| pka | 12.89±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1808149 |
| InChI | InChI=1S/C9H4F16O/c10-2(11)4(14,15)6(18,19)8(22,23)9(24,25)7(20,21)5(16,17)3(12,13)1-26/h2,26H,1H2 |
| InChIKey | MSXVQELLSMPBFD-UHFFFAOYSA-N |
| SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| CAS DataBase Reference | 376-18-1(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | 255P4FQ8SA |
| NIST Chemistry Reference | 1H,1h,9h-hexadecafluoro-1-nonanol(376-18-1) |
| EPA Substance Registry System | 1-Nonanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro- (376-18-1) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H303 | |||||||||
| Precautionary statements | P270-P301+P312-P403-P501c | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36/37/39-44 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | RA7905000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29055900 | |||||||||
| Toxicity | mouse,LD50,intraperitoneal,251mg/kg (251mg/kg),Zeitschrift fuer die Gesamte Hygiene und Ihre Grenzgebiete. Vol. 26, Pg. 9, 1980. | |||||||||
| NFPA 704: |
|
