Hexadecafluorosebacic acid
- Product NameHexadecafluorosebacic acid
- CAS307-78-8
- CBNumberCB5337510
- MFC10H2F16O4
- MW490.09
- MDL NumberMFCD00042365
- MOL File307-78-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 151-160 °C(lit.) |
| Boiling point | 225°C 60mm |
| Density | 1.7502 (estimate) |
| form | powder to crystal |
| pka | 0.22±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1898292 |
| InChI | 1S/C10H2F16O4/c11-3(12,1(27)28)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2(29)30/h(H,27,28)(H,29,30) |
| InChIKey | YPCSMEGZIYWAAZ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference | 307-78-8(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorosebacic acid (307-78-8) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H332-H351-H360D-H362-H372 | |||||||||
| Precautionary statements | P202-P260-P263-P301+P312-P304+P340+P312-P308+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 3261 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29171900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 | |||||||||
| NFPA 704: |
|

