1H,1H,10H,10H-Perfluoro-1,10-decanediol
- Product Name1H,1H,10H,10H-Perfluoro-1,10-decanediol
- CAS754-96-1
- CBNumberCB0102265
- MFC10H6F16O2
- MW462.13
- MDL NumberMFCD00192200
- MOL File754-96-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 135-137 °C (lit.) |
| Boiling point | 132 °C/4 mmHg (lit.) |
| Density | 1.6113 (estimate) |
| Flash point | 132°C/4mm |
| form | powder to crystal |
| pka | 12.59±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1894671 |
| InChI | 1S/C10H6F16O2/c11-3(12,1-27)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2-28/h27-28H,1-2H2 |
| InChIKey | NSKCTPBWPZPFHW-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| CAS DataBase Reference | 754-96-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,10H,10H-Perfluorodecane-1,10-diol (754-96-1) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H332-H351-H360D-H362-H372-H411 | |||||||||
| Precautionary statements | P260-P263-P273-P301+P312-P304+P340+P312-P308+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 29055900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Lact. Repr. 1B STOT RE 1 | |||||||||
| NFPA 704: |
|

