1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL
- Product Name1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL
- CAS754-96-1
- MFC10H6F16O2
- MW462.13
- EINECS
- MOL File754-96-1.mol
Chemical Properties
| Melting point | 135-137 °C (lit.) |
| Boiling point | 132 °C/4 mmHg (lit.) |
| Density | 1.6113 (estimate) |
| Flash point | 132°C/4mm |
| form | powder to crystal |
| pka | 12.59±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1894671 |
| InChI | 1S/C10H6F16O2/c11-3(12,1-27)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2-28/h27-28H,1-2H2 |
| InChIKey | NSKCTPBWPZPFHW-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| CAS DataBase Reference | 754-96-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,10H,10H-Perfluorodecane-1,10-diol (754-96-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29055900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Lact. Repr. 1B STOT RE 1 |
