335-76-2
| Name | PERFLUORODECANOIC ACID |
| CAS | 335-76-2 |
| EINECS(EC#) | 206-400-3 |
| Molecular Formula | C10HF19O2 |
| MDL Number | MFCD00004175 |
| Molecular Weight | 514.08 |
| MOL File | 335-76-2.mol |
Chemical Properties
| Appearance | white crystalline powder |
| Melting point | 77-81 °C (lit.) |
| Boiling point | 218 °C/740 mmHg (lit.) |
| density | 1.7490 (estimate) |
| vapor pressure | ~10 mm Hg ( 0 °C) |
| Fp | 218°C |
| storage temp. | 2-8°C |
| solubility | methanol: soluble10%, clear to very slightly hazy, colorless to faintly yellow |
| form | A liquid |
| pka | 0.52±0.10(Predicted) |
| color | White to Almost white |
| Stability: | Stable. Incompatible with strong bases, oxidizing agents, reducing agents. |
| BRN | 1810811 |
| InChI | 1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
| InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 335-76-2(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorodecanoic acid (335-76-2) |
Safety Data
| Hazard Codes | T,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HD9900000 |
| Hazard Note | Corrosive |
| TSCA | T |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Lact. Repr. 1B |
| Safety Profile | |
| Toxicity |