5-Fluoro-1,3-isobenzofurandione
- Product Name5-Fluoro-1,3-isobenzofurandione
- CAS319-03-9
- CBNumberCB5204430
- MFC8H3FO3
- MW166.11
- EINECS1312995-182-4
- MDL NumberMFCD00191363
- MOL File319-03-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 75-79 °C (lit.) |
| Boiling point | 148°C 20mm |
| Density | 1.55 |
| Flash point | >93°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in sodium hydroxide. |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 131281 |
| InChI | InChI=1S/C8H3FO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| InChIKey | XVMKZAAFVWXIII-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(F)C=C2)C(=O)O1 |
| CAS DataBase Reference | 319-03-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, 5-fluoro- (319-03-9) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-36/37/38-42/43 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT, MOISTURE SENSITIVE | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29173990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
