
319-03-9
| Name | 5-Fluoro-1,3-isobenzofurandione |
| CAS | 319-03-9 |
| EINECS(EC#) | 1312995-182-4 |
| Molecular Formula | C8H3FO3 |
| MDL Number | MFCD00191363 |
| Molecular Weight | 166.11 |
| MOL File | 319-03-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 75-79 °C (lit.) |
| Boiling point | 148°C 20mm |
| density | 1.55 |
| Fp | >93°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in sodium hydroxide. |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 131281 |
| InChI | InChI=1S/C8H3FO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| InChIKey | XVMKZAAFVWXIII-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(F)C=C2)C(=O)O1 |
| CAS DataBase Reference | 319-03-9(CAS DataBase Reference) |
| EPA Substance Registry System | 319-03-9(EPA Substance) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT, MOISTURE SENSITIVE |
| PackingGroup | Ⅲ |
| HS Code | 29173990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |