641-70-3
| Name | 3-Nitrophthalic anhydride |
| CAS | 641-70-3 |
| EINECS(EC#) | 211-373-6 |
| Molecular Formula | C8H3NO5 |
| MDL Number | MFCD00005921 |
| Molecular Weight | 193.11 |
| MOL File | 641-70-3.mol |
Chemical Properties
| Appearance | Beige to yellow crystalline powder |
| Melting point | 163-165 °C (lit.) |
| Boiling point | 329.3°C (rough estimate) |
| density | 1.6392 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Store at RT. |
| form | Crystalline Powder |
| color | Beige to yellow |
| Water Solubility | MAY DECOMPOSE |
| Sensitive | Moisture Sensitive |
| Usage | An intermediate for the synthesis of a benzimidazole PARP inhibitor I (succinate salt) (ABT-472) |
| BRN | 179963 |
| InChI | InChI=1S/C8H3NO5/c10-7-4-2-1-3-5(9(12)13)6(4)8(11)14-7/h1-3H |
| InChIKey | ROFZMKDROVBLNY-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)O1 |
| CAS DataBase Reference | 641-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitrophthalic anhydride(641-70-3) |
| EPA Substance Registry System | 641-70-3(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
