935-79-5
| Name | cis-1,2,3,6-Tetrahydrophthalic anhydride |
| CAS | 935-79-5 |
| EINECS(EC#) | 213-308-7 |
| Molecular Formula | C8H8O3 |
| MDL Number | MFCD00065335 |
| Molecular Weight | 152.15 |
| MOL File | 935-79-5.mol |
Chemical Properties
| Appearance | WHITE FLAKES |
| Melting point | 98 °C |
| Boiling point | 234.6°C (rough estimate) |
| density | 1.2143 (rough estimate) |
| vapor density | 5.2 (vs air) |
| vapor pressure | <0.01 mm Hg ( 20 °C) |
| refractive index | 1.4447 (estimate) |
| Fp | 156 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene,Benzene |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| BRN | 82341 |
| Exposure limits | ACGIH: TWA 0.01 mg/m3 OSHA: TWA 0.25 ppm(1 mg/m3) NIOSH: IDLH 10 mg/m3; TWA 0.25 ppm(1 mg/m3) |
| InChI | 1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-2,5-6H,3-4H2/t5-,6+ |
| InChIKey | KMOUUZVZFBCRAM-OLQVQODUSA-N |
| SMILES | [H][C@@]12CC=CC[C@]1([H])C(=O)OC2=O |
Safety Data
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H334-H412 |
| Precautionary statements | P261-P273-P280-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2698 8/PG 3 |
| WGK Germany | 3 |
| RTECS | GW5775000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29173990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |