603-62-3
| Name | 3-Nitrophthalimide |
| CAS | 603-62-3 |
| EINECS(EC#) | 210-051-2 |
| Molecular Formula | C8H4N2O4 |
| MDL Number | MFCD00041852 |
| Molecular Weight | 192.13 |
| MOL File | 603-62-3.mol |
Chemical Properties
| Appearance | yellow to straw-yellow crystalline powder |
| Melting point | 213-215 °C(lit.) |
| Boiling point | 328.09°C (rough estimate) |
| density | 1.5513 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 8.13±0.20(Predicted) |
| color | Yellow to straw-yellow |
| Water Solubility | Insoluble in water. |
| BRN | 179965 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C8H4N2O4/c11-7-4-2-1-3-5(10(13)14)6(4)8(12)9-7/h1-3H,(H,9,11,12) |
| InChIKey | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)N1 |
| CAS DataBase Reference | 603-62-3(CAS DataBase Reference) |
| EPA Substance Registry System | 603-62-3(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |