
787-70-2
| Name | Biphenyl-4,4'-dicarboxylic acid |
| CAS | 787-70-2 |
| EINECS(EC#) | 212-328-3 |
| Molecular Formula | C14H10O4 |
| MDL Number | MFCD00002554 |
| Molecular Weight | 242.23 |
| MOL File | 787-70-2.mol |
Chemical Properties
| Appearance | White to light beige powder |
| Melting point | >300 °C(lit.) |
| Boiling point | 482.5±38.0 °C(Predicted) |
| density | 1.347±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 3.77±0.10(Predicted) |
| color | White to light beige |
| BRN | 523308 |
| InChI | InChI=1S/C14H10O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | NEQFBGHQPUXOFH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(O)=O)C=C2)=CC=C(C(O)=O)C=C1 |
| CAS DataBase Reference | 787-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | 787-70-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DV2975000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

