Pentachloroaniline
- Product NamePentachloroaniline
- CAS527-20-8
- CBNumberCB4756563
- MFC6H2Cl5N
- MW265.35
- EINECS208-410-3
- MDL NumberMFCD00014769
- MOL File527-20-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 232 °C |
| Boiling point | 335.8±37.0 °C(Predicted) |
| Density | 1.751±0.06 g/cm3(Predicted) |
| Flash point | 100 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | -2.04±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Air & Light Sensitive |
| BRN | 2806732 |
| Henry's Law Constant | 2.3×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 527-20-8(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331-H373-H410 | |||||||||
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P314 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 20/21/22-36/37/38-23/24/25-33-50/53 | |||||||||
| Safety Statements | 26-36/37/39-45-22-36/37-61-60-28 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BY7910000 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214200 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 | |||||||||
| Hazardous Substances Data | 527-20-8(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
