527-20-8
| Name | Pentachloroaniline |
| CAS | 527-20-8 |
| EINECS(EC#) | 208-410-3 |
| Molecular Formula | C6H2Cl5N |
| MDL Number | MFCD00014769 |
| Molecular Weight | 265.35 |
| MOL File | 527-20-8.mol |
Chemical Properties
| Melting point | 232 °C |
| Boiling point | 335.8±37.0 °C(Predicted) |
| density | 1.751±0.06 g/cm3(Predicted) |
| Fp | 100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated) |
| form | neat |
| pka | -2.04±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Air & Light Sensitive |
| BRN | 2806732 |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 527-20-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentachloroaniline(527-20-8) |
| EPA Substance Registry System | Benzenamine, 2,3,4,5,6-pentachloro- (527-20-8) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BY7910000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Hazardous Substances Data | 527-20-8(Hazardous Substances Data) |