Diethyl oxalacetate sodium salt
- Product NameDiethyl oxalacetate sodium salt
- CAS40876-98-0
- CBNumberCB4473950
- MFC8H11NaO5
- MW210.16
- EINECS255-122-9
- MDL NumberMFCD00035571
- MOL File40876-98-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 188-190 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Beige to light orange |
| Water Solubility | Slightly soluble in water (1.2 g/L) (25°C). |
| Sensitive | Moisture Sensitive |
| BRN | 4279609 |
| InChI | InChI=1S/C8H11O5.Na/c1-3-12-7(10)5-6(9)8(11)13-4-2;/h5H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | JPTKZRPOIUYFTM-UHFFFAOYSA-N |
| SMILES | [CH-](C(=O)OCC)C(=O)C(=O)OCC.[Na+] |
| CAS DataBase Reference | 40876-98-0(CAS DataBase Reference) |
| FDA UNII | 6CA025Y4FG |
| EPA Substance Registry System | Butanedioic acid, oxo-, diethyl ester, ion(1-), sodium (40876-98-0) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 45-46-48/20/21/22-36-36/38 | |||||||||
| Safety Statements | 26-24/25-45-53 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | EK0115500 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29183000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 | |||||||||
| Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 9, 1953. | |||||||||
| NFPA 704: |
|
