Diethyl oxalacetate sodium salt
- Product NameDiethyl oxalacetate sodium salt
- CAS40876-98-0
- MFC8H11NaO5
- MW210.16
- EINECS255-122-9
- MOL File40876-98-0.mol
Chemical Properties
| Melting point | 188-190 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Beige to light orange |
| Water Solubility | Slightly soluble in water (1.2 g/L) (25°C). |
| Sensitive | Moisture Sensitive |
| BRN | 4279609 |
| InChI | InChI=1S/C8H11O5.Na/c1-3-12-7(10)5-6(9)8(11)13-4-2;/h5H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | JPTKZRPOIUYFTM-UHFFFAOYSA-N |
| SMILES | [CH-](C(=O)OCC)C(=O)C(=O)OCC.[Na+] |
| CAS DataBase Reference | 40876-98-0(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, oxo-, diethyl ester, ion(1-), sodium (40876-98-0) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 45-46-48/20/21/22-36-36/38 |
| Safety Statements | 26-24/25-45-53 |
| WGK Germany | 3 |
| RTECS | EK0115500 |
| TSCA | TSCA listed |
| HS Code | 29183000 |
| Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 9, 1953. |
