![3,7,9-Trihydroxy-1-methyl-6H-dibenzo[b,d]pyran-6-one Structure](https://www.chemicalbook.com/CAS/GIF/641-38-3.gif)
3,7,9-Trihydroxy-1-methyl-6H-dibenzo[b,d]pyran-6-one
- Product Name3,7,9-Trihydroxy-1-methyl-6H-dibenzo[b,d]pyran-6-one
- CAS641-38-3
- CBNumberCB3297090
- MFC14H10O5
- MW258.23
- MDL NumberMFCD00133068
- MOL File641-38-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 350°C (rough estimate) |
| Boiling point | 321.48°C (rough estimate) |
| Density | 1.2211 (rough estimate) |
| refractive index | 1.4560 (estimate) |
| storage temp. | 2-8°C |
| solubility | ≤0.5mg/ml in ethanol;30mg/ml in DMSO;30mg/ml in dimethyl formamide |
| pka | 7.16±0.20(Predicted) |
| form | Solid |
| color | Off-white to brown |
| BRN | 244839 |
| Stability | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| InChIKey | CEBXXEKPIIDJHL-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc2OC(=O)c3c(O)cc(O)cc3-c12 |
| FDA UNII | KN9L4260JW |
| UNSPSC Code | 85151701 |
| NACRES | NA.77 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300+H310+H330 | |||||||||
| Precautionary statements | P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 | |||||||||
| Hazard Codes | T+ | |||||||||
| Risk Statements | 26/27/28 | |||||||||
| Safety Statements | 28-36/37/39-45 | |||||||||
| RIDADR | UN 3462 6.1/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | HP8757000 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29322090 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral | |||||||||
| Toxicity | LDLo intraperitoneal in mouse: 100mg/kg | |||||||||
| NFPA 704: |
|
