
641-38-3
| Name | 3,7,9-TRIHYDROXY-1-METHYL-6H-DIBENZO[B,D]PYRAN-6-ONE |
| CAS | 641-38-3 |
| Molecular Formula | C14H10O5 |
| MDL Number | MFCD00133068 |
| Molecular Weight | 258.23 |
| MOL File | 641-38-3.mol |
Chemical Properties
| Melting point | 350°C (rough estimate) |
| Boiling point | 321.48°C (rough estimate) |
| density | 1.2211 (rough estimate) |
| refractive index | 1.4560 (estimate) |
| storage temp. | 2-8°C |
| solubility | ≤0.5mg/ml in ethanol;30mg/ml in DMSO;30mg/ml in dimethyl formamide |
| form | neat |
| pka | 7.16±0.20(Predicted) |
| color | Off-white to brown |
| BRN | 244839 |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| InChIKey | CEBXXEKPIIDJHL-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc2OC(=O)c3c(O)cc(O)cc3-c12 |
Safety Data
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | HP8757000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29322090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
| Toxicity |