![Benz[cd]indol-2(1H)-one Structure](https://www.chemicalbook.com/CAS/GIF/130-00-7.gif)
Benz[cd]indol-2(1H)-one
- Product NameBenz[cd]indol-2(1H)-one
- CAS130-00-7
- CBNumberCB3257311
- MFC11H7NO
- MW169.18
- EINECS204-973-4
- MDL NumberMFCD00009748
- MOL File130-00-7.mol
Chemical Properties
| Melting point | 173-178 °C(lit.) |
| Boiling point | 298.46°C (rough estimate) |
| Density | 1.1616 (rough estimate) |
| vapor pressure | 0.61-7.2Pa at 100-130℃ |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: soluble25mg/mL, clear to slightly hazy, yellow to brown |
| pka | 13.27±0.20(Predicted) |
| form | Powder |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C11H7NO/c13-11-8-5-1-3-7-4-2-6-9(12-11)10(7)8/h1-6H,(H,12,13) |
| InChIKey | GPYLCFQEKPUWLD-UHFFFAOYSA-N |
| SMILES | N1C2=C3C(C=CC=C3C1=O)=CC=C2 |
| LogP | 2.5 at 24℃ and pH6.6 |
| CAS DataBase Reference | 130-00-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benz[cd]indol-2(1H)-one (130-00-7) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302 | |||||||||
| Precautionary statements | P264-P270-P301+P312+P330-P501 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | DE3202000 | |||||||||
| HS Code | 29337900 | |||||||||
| Toxicity | mammal (species unspecified),LD50,oral,2700mg/kg (2700mg/kg),BEHAVIORAL: ALTERED SLEEP TIME (INCLUDING CHANGE IN RIGHTING REFLEX)BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY),Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 51(1), Pg. 82, 1986. | |||||||||
| NFPA 704: |
|
