Acetylferrocene
- Product NameAcetylferrocene
- CAS1271-55-2
- CBNumberCB3165427
- MFC12H12FeO10*
- MW228.07
- EINECS215-043-2
- MDL NumberMFCD00001432
- MOL File1271-55-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 81-83 °C (lit.) |
| Boiling point | 160-163 °C (3.0004 mmHg) |
| Density | >1 g/cm3 (20℃) |
| Flash point | 160-163°C/4mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Needle-Like Crystalline Powder |
| color | Orange |
| Water Solubility | insoluble |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability | Stable. Incompatible with strong oxidizing agents, reducing agents, strong acids, strong bases. |
| InChI | InChI=1S/C7H7O.C5H5.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,1H3;1-5H; |
| InChIKey | PHMAOJNZIFULOG-UHFFFAOYSA-N |
| SMILES | [C]1(C(=O)C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,4,5,6,7,8,9,10,11,12| |
| CAS DataBase Reference | 1271-55-2(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| NIST Chemistry Reference | Acetylferrocene(1271-55-2) |
| EPA Substance Registry System | Ferrocene, acetyl- (1271-55-2) |
| UNSPSC Code | 12161600 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300+H310 | |||||||||
| Precautionary statements | P262-P264-P270-P280-P301+P310-P302+P352+P310 | |||||||||
| Hazard Codes | T+ | |||||||||
| Risk Statements | 28 | |||||||||
| Safety Statements | 28-36/37-45-28A-1 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | OB3700000 | |||||||||
| F | 10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29310095 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Oral | |||||||||
| Toxicity | LDLo orl-rat: 5 mg/kg EPASR* 8EHQ-1285-0578 | |||||||||
| NFPA 704: |
|

