Vinylferrocene
- Product NameVinylferrocene
- CAS1271-51-8
- CBNumberCB9397268
- MFC12H12Fe10*
- MW212.07
- EINECS215-041-1
- MDL NumberMFCD00001434
- MOL File1271-51-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 51-53 °C (lit.) |
| Boiling point | 80-85 °C/0.2 mmHg (lit.) |
| Flash point | 144 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | crystal |
| color | orange |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability | Stable. Highly flammable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C7H7.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-5H; |
| InChIKey | LCPVTGDQYVLJHU-UHFFFAOYSA-N |
| SMILES | [C]1(C=C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,8,9,10,11| |
| NIST Chemistry Reference | Vinylferrocene(1271-51-8) |
| UNSPSC Code | 12161600 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228 | |||||||||
| Precautionary statements | P210 | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 11-22 | |||||||||
| Safety Statements | 16-22-24/25-7/9-33 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Flam. Sol. 1 | |||||||||
| NFPA 704: |
|
